C18H16F13NaO4S — CID 101450839
sodium 2-[4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)phenyl]hexyl sulfate (PubChem CID 101450839) has the molecular formula C18H16F13NaO4S and a molecular weight of 598.35 g/mol. Its IUPAC name is sodium 2-[4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)phenyl]hexyl sulfate.
| Compound Name | sodium 2-[4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)phenyl]hexyl sulfate |
|---|---|
| PubChem CID | 101450839 |
| Molecular Formula | C18H16F13NaO4S |
| Molecular Weight | 598.35 g/mol |
| Exact Mass | 598.05 |
| IUPAC Name | sodium 2-[4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)phenyl]hexyl sulfate |
| SMILES | CCCCC(COS(=O)(=O)[O-])c1ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1.[Na+] |
| InChI | InChI=1S/C18H17F13O4S.Na/c1-2-3-4-11(9-35-36(32,33)34)10-5-7-12(8-6-10)13(19,20)14(21,22)15(23,24)16(25,26)17(27,28)18(29,30)31;/h5-8,11H,2-4,9H2,1H3,(H,32,33,34);/q;+1/p-1 |
| InChIKey | CXGKIXAGELPLFY-UHFFFAOYSA-M |
| XLogP | 3.64 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|