C9H14F6N2O2 — CID 101451071
1,1,1,3,3,3-hexafluoro-2-(2-morpholin-4-ylethylamino)propan-2-ol (PubChem CID 101451071) has the molecular formula C9H14F6N2O2 and a molecular weight of 296.21 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(2-morpholin-4-ylethylamino)propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(2-morpholin-4-ylethylamino)propan-2-ol |
|---|---|
| PubChem CID | 101451071 |
| Molecular Formula | C9H14F6N2O2 |
| Molecular Weight | 296.21 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(2-morpholin-4-ylethylamino)propan-2-ol |
| SMILES | OC(NCCN1CCOCC1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H14F6N2O2/c10-8(11,12)7(18,9(13,14)15)16-1-2-17-3-5-19-6-4-17/h16,18H,1-6H2 |
| InChIKey | HEKJNIDYKSPGAC-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.21 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|