C14H20F6N2O2 — CID 1014515
2,2,2-trifluoro-N-[[(1S,5S)-1,3,3-trimethyl-5-[(2,2,2-trifluoroacetyl)amino]cyclohexyl]methyl]acetamide (PubChem CID 1014515) has the molecular formula C14H20F6N2O2 and a molecular weight of 362.31 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[[(1S,5S)-1,3,3-trimethyl-5-[(2,2,2-trifluoroacetyl)amino]cyclohexyl]methyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[[(1S,5S)-1,3,3-trimethyl-5-[(2,2,2-trifluoroacetyl)amino]cyclohexyl]methyl]acetamide |
|---|---|
| PubChem CID | 1014515 |
| Molecular Formula | C14H20F6N2O2 |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 2,2,2-trifluoro-N-[[(1S,5S)-1,3,3-trimethyl-5-[(2,2,2-trifluoroacetyl)amino]cyclohexyl]methyl]acetamide |
| SMILES | CC1(C)C[C@H](NC(=O)C(F)(F)F)C[C@@](C)(CNC(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C14H20F6N2O2/c1-11(2)4-8(22-10(24)14(18,19)20)5-12(3,6-11)7-21-9(23)13(15,16)17/h8H,4-7H2,1-3H3,(H,21,23)(H,22,24)/t8-,12+/m0/s1 |
| InChIKey | YOWHANNOAAEALQ-QPUJVOFHSA-N |
| XLogP | 2.93 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |