C16H22O7S — CID 101451558
2,5,8,11,14-pentaoxa-19λ6-thiatricyclo[13.7.0.017,21]docosa-1(15),16,21-triene 19,19-dioxide (PubChem CID 101451558) has the molecular formula C16H22O7S and a molecular weight of 358.41 g/mol. Its IUPAC name is 2,5,8,11,14-pentaoxa-19λ6-thiatricyclo[13.7.0.017,21]docosa-1(15),16,21-triene 19,19-dioxide.
| Compound Name | 2,5,8,11,14-pentaoxa-19λ6-thiatricyclo[13.7.0.017,21]docosa-1(15),16,21-triene 19,19-dioxide |
|---|---|
| PubChem CID | 101451558 |
| Molecular Formula | C16H22O7S |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 2,5,8,11,14-pentaoxa-19λ6-thiatricyclo[13.7.0.017,21]docosa-1(15),16,21-triene 19,19-dioxide |
| SMILES | O=S1(=O)Cc2cc3c(cc2C1)OCCOCCOCCOCCO3 |
| InChI | InChI=1S/C16H22O7S/c17-24(18)11-13-9-15-16(10-14(13)12-24)23-8-6-21-4-2-19-1-3-20-5-7-22-15/h9-10H,1-8,11-12H2 |
| InChIKey | BURMEDPNDFAAOB-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |