C64H26F16N8S4 — CID 101451993
5,10,15,20-tetrakis(2,3,5,6-tetrafluoro-4-pyridin-4-ylsulfanylphenyl)-21,23-dihydroporphyrin (PubChem CID 101451993) has the molecular formula C64H26F16N8S4 and a molecular weight of 1339.20 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(2,3,5,6-tetrafluoro-4-pyridin-4-ylsulfanylphenyl)-21,23-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(2,3,5,6-tetrafluoro-4-pyridin-4-ylsulfanylphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 101451993 |
| Molecular Formula | C64H26F16N8S4 |
| Molecular Weight | 1339.20 g/mol |
| Exact Mass | 1338.09 |
| IUPAC Name | 5,10,15,20-tetrakis(2,3,5,6-tetrafluoro-4-pyridin-4-ylsulfanylphenyl)-21,23-dihydroporphyrin |
| SMILES | Fc1c(F)c(-c2c3nc(c(-c4c(F)c(F)c(Sc5ccncc5)c(F)c4F)c4ccc([nH]4)c(-c4c(F)c(F)c(Sc5ccncc5)c(F)c4F)c4nc(c(-c5c(F)c(F)c(Sc6ccncc6)c(F)c5F)c5ccc2[nH]5)C=C4)C=C3)c(F)c(F)c1Sc1ccncc1 |
| InChI | InChI=1S/C64H26F16N8S4/c65-45-41(46(66)54(74)61(53(45)73)89-25-9-17-81-18-10-25)37-29-1-2-30(85-29)38(42-47(67)55(75)62(56(76)48(42)68)90-26-11-19-82-20-12-26)32-5-6-34(87-32)40(44-51(71)59(79)64(60(80)52(44)72)92-28-15-23-84-24-16-28)36-8-7-35(88-36)39(33-4-3-31(37)86-33)43-49(69)57(77)63(58(78)50(43)70)91-27-13-21-83-22-14-27/h1-24,85,88H/b37-29+,37-31+,38-30+,38-32+,39-33+,39-35+,40-34+,40-36+ |
| InChIKey | AIAAMEJEQAMNNC-DEDBXGSUSA-N |
| XLogP | 19.73 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 92 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1339.20 |
| LogP ≤ 5 | 19.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|