C21H20O4S2 — CID 101452070
[(6E)-4-(benzenesulfonyl)nona-6,8-dien-1-yn-4-yl]sulfonylbenzene (PubChem CID 101452070) has the molecular formula C21H20O4S2 and a molecular weight of 400.52 g/mol. Its IUPAC name is [(6E)-4-(benzenesulfonyl)nona-6,8-dien-1-yn-4-yl]sulfonylbenzene.
| Compound Name | [(6E)-4-(benzenesulfonyl)nona-6,8-dien-1-yn-4-yl]sulfonylbenzene |
|---|---|
| PubChem CID | 101452070 |
| Molecular Formula | C21H20O4S2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | [(6E)-4-(benzenesulfonyl)nona-6,8-dien-1-yn-4-yl]sulfonylbenzene |
| SMILES | C#CCC(C/C=C/C=C)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H20O4S2/c1-3-5-12-18-21(17-4-2,26(22,23)19-13-8-6-9-14-19)27(24,25)20-15-10-7-11-16-20/h2-3,5-16H,1,17-18H2/b12-5+ |
| InChIKey | QBQMSYQSXLSLSN-LFYBBSHMSA-N |
| XLogP | 3.79 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|