C22H16Cl2FN5OS — CID 101452323
6-(2-chloroethoxy)-4-[3-chloro-4-(1-methylimidazol-2-yl)sulfanylanilino]-7-fluoroquinoline-3-carbonitrile (PubChem CID 101452323) has the molecular formula C22H16Cl2FN5OS and a molecular weight of 488.38 g/mol. Its IUPAC name is 6-(2-chloroethoxy)-4-[3-chloro-4-(1-methylimidazol-2-yl)sulfanylanilino]-7-fluoroquinoline-3-carbonitrile.
| Compound Name | 6-(2-chloroethoxy)-4-[3-chloro-4-(1-methylimidazol-2-yl)sulfanylanilino]-7-fluoroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 101452323 |
| Molecular Formula | C22H16Cl2FN5OS |
| Molecular Weight | 488.38 g/mol |
| Exact Mass | 487.04 |
| IUPAC Name | 6-(2-chloroethoxy)-4-[3-chloro-4-(1-methylimidazol-2-yl)sulfanylanilino]-7-fluoroquinoline-3-carbonitrile |
| SMILES | Cn1ccnc1Sc1ccc(Nc2c(C#N)cnc3cc(F)c(OCCCl)cc23)cc1Cl |
| InChI | InChI=1S/C22H16Cl2FN5OS/c1-30-6-5-27-22(30)32-20-3-2-14(8-16(20)24)29-21-13(11-26)12-28-18-10-17(25)19(9-15(18)21)31-7-4-23/h2-3,5-6,8-10,12H,4,7H2,1H3,(H,28,29) |
| InChIKey | DGFNDGKPAITDJR-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.38 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|