About N-butyl-3-[(2,4-dimethoxyphenyl)-hydroxy-perylen-3-ylmethyl]benzamide
N-butyl-3-[(2,4-dimethoxyphenyl)-hydroxy-perylen-3-ylmethyl]benzamide (PubChem CID 10145235) has the molecular formula C40H35NO4
and a molecular weight of 593.72 g/mol. Its IUPAC name is N-butyl-3-[(2,4-dimethoxyphenyl)-hydroxy-perylen-3-ylmethyl]benzamide.
Molecular Properties
| Compound Name | N-butyl-3-[(2,4-dimethoxyphenyl)-hydroxy-perylen-3-ylmethyl]benzamide |
| PubChem CID | 10145235 |
| Molecular Formula | C40H35NO4 |
| Molecular Weight | 593.72 g/mol |
| Exact Mass | 593.26 |
| IUPAC Name | N-butyl-3-[(2,4-dimethoxyphenyl)-hydroxy-perylen-3-ylmethyl]benzamide |
| SMILES | CCCCNC(=O)c1cccc(C(O)(c2ccc(OC)cc2OC)c2ccc3c4cccc5cccc(c6cccc2c63)c54)c1 |
| InChI | InChI=1S/C40H35NO4/c1-4-5-22-41-39(42)26-12-6-13-27(23-26)40(43,35-20-18-28(44-2)24-36(35)45-3)34-21-19-32-30-15-8-11-25-10-7-14-29(37(25)30)31-16-9-17-33(34)38(31)32/h6-21,23-24,43H,4-5,22H2,1-3H3,(H,41,42) |
| InChIKey | MJZMBAPKTITPMD-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 593.72 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-3-[(2,4-dimethoxyphenyl)-hydroxy-perylen-3-ylmethyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-3-[(2,4-dimethoxyphenyl)-hydroxy-perylen-3-ylmethyl]benzamide?
The IUPAC name of N-butyl-3-[(2,4-dimethoxyphenyl)-hydroxy-perylen-3-ylmethyl]benzamide (CID 10145235) is N-butyl-3-[(2,4-dimethoxyphenyl)-hydroxy-perylen-3-ylmethyl]benzamide.
What is the SMILES notation for N-butyl-3-[(2,4-dimethoxyphenyl)-hydroxy-perylen-3-ylmethyl]benzamide?
The canonical SMILES for N-butyl-3-[(2,4-dimethoxyphenyl)-hydroxy-perylen-3-ylmethyl]benzamide is CCCCNC(=O)c1cccc(C(O)(c2ccc(OC)cc2OC)c2ccc3c4cccc5cccc(c6cccc2c63)c54)c1.
What is the InChIKey of N-butyl-3-[(2,4-dimethoxyphenyl)-hydroxy-perylen-3-ylmethyl]benzamide?
The InChIKey is MJZMBAPKTITPMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H35NO4/c1-4-5-22-41-39(42)26-12-6-13-27(23-26)40(43,35-20-18-28(44-2)24-36(35)45-3)34-21-19-32-30-15-8-11-25-10-7-14-29(37(25)30)31-16-9-17-33(34)38(31)32/h6-21,23-24,43H,4-5,22H2,1-3H3,(H,41,42).
What are the key properties of N-butyl-3-[(2,4-dimethoxyphenyl)-hydroxy-perylen-3-ylmethyl]benzamide?
N-butyl-3-[(2,4-dimethoxyphenyl)-hydroxy-perylen-3-ylmethyl]benzamide has a molecular weight of 593.72 g/mol, XLogP of 8.57, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-3-[(2,4-dimethoxyphenyl)-hydroxy-perylen-3-ylmethyl]benzamide is sourced from PubChem (CID 10145235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).