C10H14N2O2 — CID 101452359
(4E,10E)-1,7-diazacyclododeca-4,10-diene-2,8-dione (PubChem CID 101452359) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is (4E,10E)-1,7-diazacyclododeca-4,10-diene-2,8-dione.
| Compound Name | (4E,10E)-1,7-diazacyclododeca-4,10-diene-2,8-dione |
|---|---|
| PubChem CID | 101452359 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | (4E,10E)-1,7-diazacyclododeca-4,10-diene-2,8-dione |
| SMILES | O=C1C/C=C/CNC(=O)C/C=C/CN1 |
| InChI | InChI=1S/C10H14N2O2/c13-9-5-1-3-7-11-10(14)6-2-4-8-12-9/h1-4H,5-8H2,(H,11,14)(H,12,13)/b3-1+,4-2+ |
| InChIKey | JOPHXOFCEBXHOH-ZPUQHVIOSA-N |
| XLogP | 0.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|