C26H25F7N2O4S — CID 10145244
1-[5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-1,3-thiazol-2-yl]-1-cyclohexyl-2,2,2-trifluoroethanol (PubChem CID 10145244) has the molecular formula C26H25F7N2O4S and a molecular weight of 594.55 g/mol. Its IUPAC name is 1-[5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-1,3-thiazol-2-yl]-1-cyclohexyl-2,2,2-trifluoroethanol.
| Compound Name | 1-[5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-1,3-thiazol-2-yl]-1-cyclohexyl-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 10145244 |
| Molecular Formula | C26H25F7N2O4S |
| Molecular Weight | 594.55 g/mol |
| Exact Mass | 594.14 |
| IUPAC Name | 1-[5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-1,3-thiazol-2-yl]-1-cyclohexyl-2,2,2-trifluoroethanol |
| SMILES | [O-][n+]1ccc(CC(c2ccc(OC(F)F)c(OC(F)F)c2)c2cnc(C(O)(C3CCCCC3)C(F)(F)F)s2)cc1 |
| InChI | InChI=1S/C26H25F7N2O4S/c27-23(28)38-19-7-6-16(13-20(19)39-24(29)30)18(12-15-8-10-35(37)11-9-15)21-14-34-22(40-21)25(36,26(31,32)33)17-4-2-1-3-5-17/h6-11,13-14,17-18,23-24,36H,1-5,12H2 |
| InChIKey | OBPMUWJDCDUFPA-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.55 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|