C29H30F2N4O2S — CID 101452494
1-[(6aR,10aS)-2-ethylsulfanyl-11-[(4-fluorophenyl)methyl]-6-oxo-6a,7,8,9,10,10a-hexahydro-5H-benzo[b][1,4]benzodiazepin-3-yl]-3-(4-fluorophenyl)urea (PubChem CID 101452494) has the molecular formula C29H30F2N4O2S and a molecular weight of 536.65 g/mol. Its IUPAC name is 1-[(6aR,10aS)-2-ethylsulfanyl-11-[(4-fluorophenyl)methyl]-6-oxo-6a,7,8,9,10,10a-hexahydro-5H-benzo[b][1,4]benzodiazepin-3-yl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[(6aR,10aS)-2-ethylsulfanyl-11-[(4-fluorophenyl)methyl]-6-oxo-6a,7,8,9,10,10a-hexahydro-5H-benzo[b][1,4]benzodiazepin-3-yl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 101452494 |
| Molecular Formula | C29H30F2N4O2S |
| Molecular Weight | 536.65 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | 1-[(6aR,10aS)-2-ethylsulfanyl-11-[(4-fluorophenyl)methyl]-6-oxo-6a,7,8,9,10,10a-hexahydro-5H-benzo[b][1,4]benzodiazepin-3-yl]-3-(4-fluorophenyl)urea |
| SMILES | CCSc1cc2c(cc1NC(=O)Nc1ccc(F)cc1)NC(=O)[C@@H]1CCCC[C@@H]1N2Cc1ccc(F)cc1 |
| InChI | InChI=1S/C29H30F2N4O2S/c1-2-38-27-16-26-23(15-24(27)34-29(37)32-21-13-11-20(31)12-14-21)33-28(36)22-5-3-4-6-25(22)35(26)17-18-7-9-19(30)10-8-18/h7-16,22,25H,2-6,17H2,1H3,(H,33,36)(H2,32,34,37)/t22-,25+/m1/s1 |
| InChIKey | WLKSJKUOMWHNIU-RDGATRHJSA-N |
| XLogP | 7.24 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.65 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |