C14H5F11O2 — CID 101452611
2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)chromen-4-one (PubChem CID 101452611) has the molecular formula C14H5F11O2 and a molecular weight of 414.17 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)chromen-4-one.
| Compound Name | 2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)chromen-4-one |
|---|---|
| PubChem CID | 101452611 |
| Molecular Formula | C14H5F11O2 |
| Molecular Weight | 414.17 g/mol |
| Exact Mass | 414.01 |
| IUPAC Name | 2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)chromen-4-one |
| SMILES | O=c1cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)oc2ccccc12 |
| InChI | InChI=1S/C14H5F11O2/c15-10(16,9-5-7(26)6-3-1-2-4-8(6)27-9)11(17,18)12(19,20)13(21,22)14(23,24)25/h1-5H |
| InChIKey | SUBFLVBFXTXMTH-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.17 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|