About S-tert-butyl 2-[(3S)-1-ethyl-2,5-dioxopyrrolidin-3-yl]-3-oxobutanethioate
S-tert-butyl 2-[(3S)-1-ethyl-2,5-dioxopyrrolidin-3-yl]-3-oxobutanethioate (PubChem CID 101452677) has the molecular formula C14H21NO4S
and a molecular weight of 299.39 g/mol. Its IUPAC name is S-tert-butyl 2-[(3S)-1-ethyl-2,5-dioxopyrrolidin-3-yl]-3-oxobutanethioate.
Molecular Properties
| Compound Name | S-tert-butyl 2-[(3S)-1-ethyl-2,5-dioxopyrrolidin-3-yl]-3-oxobutanethioate |
| PubChem CID | 101452677 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | S-tert-butyl 2-[(3S)-1-ethyl-2,5-dioxopyrrolidin-3-yl]-3-oxobutanethioate |
| SMILES | CCN1C(=O)C[C@@H](C(C(C)=O)C(=O)SC(C)(C)C)C1=O |
| InChI | InChI=1S/C14H21NO4S/c1-6-15-10(17)7-9(12(15)18)11(8(2)16)13(19)20-14(3,4)5/h9,11H,6-7H2,1-5H3/t9-,11?/m0/s1 |
| InChIKey | HGJKXNXXBPPJSK-FTNKSUMCSA-N |
| XLogP | 1.64 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-tert-butyl 2-[(3S)-1-ethyl-2,5-dioxopyrrolidin-3-yl]-3-oxobutanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-tert-butyl 2-[(3S)-1-ethyl-2,5-dioxopyrrolidin-3-yl]-3-oxobutanethioate?
The IUPAC name of S-tert-butyl 2-[(3S)-1-ethyl-2,5-dioxopyrrolidin-3-yl]-3-oxobutanethioate (CID 101452677) is S-tert-butyl 2-[(3S)-1-ethyl-2,5-dioxopyrrolidin-3-yl]-3-oxobutanethioate.
What is the SMILES notation for S-tert-butyl 2-[(3S)-1-ethyl-2,5-dioxopyrrolidin-3-yl]-3-oxobutanethioate?
The canonical SMILES for S-tert-butyl 2-[(3S)-1-ethyl-2,5-dioxopyrrolidin-3-yl]-3-oxobutanethioate is CCN1C(=O)C[C@@H](C(C(C)=O)C(=O)SC(C)(C)C)C1=O.
What is the InChIKey of S-tert-butyl 2-[(3S)-1-ethyl-2,5-dioxopyrrolidin-3-yl]-3-oxobutanethioate?
The InChIKey is HGJKXNXXBPPJSK-FTNKSUMCSA-N. The full InChI is InChI=1S/C14H21NO4S/c1-6-15-10(17)7-9(12(15)18)11(8(2)16)13(19)20-14(3,4)5/h9,11H,6-7H2,1-5H3/t9-,11?/m0/s1.
What are the key properties of S-tert-butyl 2-[(3S)-1-ethyl-2,5-dioxopyrrolidin-3-yl]-3-oxobutanethioate?
S-tert-butyl 2-[(3S)-1-ethyl-2,5-dioxopyrrolidin-3-yl]-3-oxobutanethioate has a molecular weight of 299.39 g/mol, XLogP of 1.64, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-tert-butyl 2-[(3S)-1-ethyl-2,5-dioxopyrrolidin-3-yl]-3-oxobutanethioate is sourced from PubChem (CID 101452677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).