About 4,6-dibromo-5-[[4-(diethylamino)phenyl]diazenyl]-2-propylisoindole-1,3-dione
4,6-dibromo-5-[[4-(diethylamino)phenyl]diazenyl]-2-propylisoindole-1,3-dione (PubChem CID 101452714) has the molecular formula C21H22Br2N4O2
and a molecular weight of 522.24 g/mol. Its IUPAC name is 4,6-dibromo-5-[[4-(diethylamino)phenyl]diazenyl]-2-propylisoindole-1,3-dione.
Molecular Properties
| Compound Name | 4,6-dibromo-5-[[4-(diethylamino)phenyl]diazenyl]-2-propylisoindole-1,3-dione |
| PubChem CID | 101452714 |
| Molecular Formula | C21H22Br2N4O2 |
| Molecular Weight | 522.24 g/mol |
| Exact Mass | 520.01 |
| IUPAC Name | 4,6-dibromo-5-[[4-(diethylamino)phenyl]diazenyl]-2-propylisoindole-1,3-dione |
| SMILES | CCCN1C(=O)c2cc(Br)c(/N=N/c3ccc(N(CC)CC)cc3)c(Br)c2C1=O |
| InChI | InChI=1S/C21H22Br2N4O2/c1-4-11-27-20(28)15-12-16(22)19(18(23)17(15)21(27)29)25-24-13-7-9-14(10-8-13)26(5-2)6-3/h7-10,12H,4-6,11H2,1-3H3/b25-24+ |
| InChIKey | OVIPINZKKKIGPW-OCOZRVBESA-N |
| XLogP | 6.48 |
| TPSA | 65.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 522.24 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4,6-dibromo-5-[[4-(diethylamino)phenyl]diazenyl]-2-propylisoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dibromo-5-[[4-(diethylamino)phenyl]diazenyl]-2-propylisoindole-1,3-dione?
The IUPAC name of 4,6-dibromo-5-[[4-(diethylamino)phenyl]diazenyl]-2-propylisoindole-1,3-dione (CID 101452714) is 4,6-dibromo-5-[[4-(diethylamino)phenyl]diazenyl]-2-propylisoindole-1,3-dione.
What is the SMILES notation for 4,6-dibromo-5-[[4-(diethylamino)phenyl]diazenyl]-2-propylisoindole-1,3-dione?
The canonical SMILES for 4,6-dibromo-5-[[4-(diethylamino)phenyl]diazenyl]-2-propylisoindole-1,3-dione is CCCN1C(=O)c2cc(Br)c(/N=N/c3ccc(N(CC)CC)cc3)c(Br)c2C1=O.
What is the InChIKey of 4,6-dibromo-5-[[4-(diethylamino)phenyl]diazenyl]-2-propylisoindole-1,3-dione?
The InChIKey is OVIPINZKKKIGPW-OCOZRVBESA-N. The full InChI is InChI=1S/C21H22Br2N4O2/c1-4-11-27-20(28)15-12-16(22)19(18(23)17(15)21(27)29)25-24-13-7-9-14(10-8-13)26(5-2)6-3/h7-10,12H,4-6,11H2,1-3H3/b25-24+.
What are the key properties of 4,6-dibromo-5-[[4-(diethylamino)phenyl]diazenyl]-2-propylisoindole-1,3-dione?
4,6-dibromo-5-[[4-(diethylamino)phenyl]diazenyl]-2-propylisoindole-1,3-dione has a molecular weight of 522.24 g/mol, XLogP of 6.48, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dibromo-5-[[4-(diethylamino)phenyl]diazenyl]-2-propylisoindole-1,3-dione is sourced from PubChem (CID 101452714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).