C14H22O — CID 101452750
trans-(1R,3R)-1,2,2-trimethyl-3-[(1E)-3-methylbuta-1,3-dienyl]cyclopentane-1-carbaldehyde (PubChem CID 101452750) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is trans-(1R,3R)-1,2,2-trimethyl-3-[(1E)-3-methylbuta-1,3-dienyl]cyclopentane-1-carbaldehyde.
| Compound Name | trans-(1R,3R)-1,2,2-trimethyl-3-[(1E)-3-methylbuta-1,3-dienyl]cyclopentane-1-carbaldehyde |
|---|---|
| PubChem CID | 101452750 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | trans-(1R,3R)-1,2,2-trimethyl-3-[(1E)-3-methylbuta-1,3-dienyl]cyclopentane-1-carbaldehyde |
| SMILES | C=C(C)/C=C/[C@H]1CC[C@@](C)(C=O)C1(C)C |
| InChI | InChI=1S/C14H22O/c1-11(2)6-7-12-8-9-14(5,10-15)13(12,3)4/h6-7,10,12H,1,8-9H2,2-5H3/b7-6+/t12-,14-/m0/s1 |
| InChIKey | QUVVMUXEADCVTF-UTTOWCGFSA-N |
| XLogP | 3.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|