C27H27NO5S — CID 101452870
(3aR,4S,6R,7S,7aR)-3-benzyl-7-hydroxy-6-(phenylmethoxymethyl)-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-pyrano[3,4-d][1,3]oxazol-2-one (PubChem CID 101452870) has the molecular formula C27H27NO5S and a molecular weight of 477.58 g/mol. Its IUPAC name is (3aR,4S,6R,7S,7aR)-3-benzyl-7-hydroxy-6-(phenylmethoxymethyl)-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-pyrano[3,4-d][1,3]oxazol-2-one.
| Compound Name | (3aR,4S,6R,7S,7aR)-3-benzyl-7-hydroxy-6-(phenylmethoxymethyl)-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-pyrano[3,4-d][1,3]oxazol-2-one |
|---|---|
| PubChem CID | 101452870 |
| Molecular Formula | C27H27NO5S |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | (3aR,4S,6R,7S,7aR)-3-benzyl-7-hydroxy-6-(phenylmethoxymethyl)-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-pyrano[3,4-d][1,3]oxazol-2-one |
| SMILES | O=C1O[C@H]2[C@H](O)[C@@H](COCc3ccccc3)O[C@@H](Sc3ccccc3)[C@@H]2N1Cc1ccccc1 |
| InChI | InChI=1S/C27H27NO5S/c29-24-22(18-31-17-20-12-6-2-7-13-20)32-26(34-21-14-8-3-9-15-21)23-25(24)33-27(30)28(23)16-19-10-4-1-5-11-19/h1-15,22-26,29H,16-18H2/t22-,23-,24-,25-,26+/m1/s1 |
| InChIKey | NIGCNLSBUIOHDT-SDVOOXDOSA-N |
| XLogP | 4.47 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |