About CID 101453034
CID 101453034 (PubChem CID 101453034) has the molecular formula C5H12BrNZn-
and a molecular weight of 231.45 g/mol.
Molecular Properties
| Compound Name | CID 101453034 |
| PubChem CID | 101453034 |
| Molecular Formula | C5H12BrNZn- |
| Molecular Weight | 231.45 g/mol |
| Exact Mass | 228.95 |
| IUPAC Name | — |
| SMILES | [Br-].[CH2]CCN(C)C.[Zn] |
| InChI | InChI=1S/C5H12N.BrH.Zn/c1-4-5-6(2)3;;/h1,4-5H2,2-3H3;1H;/p-1 |
| InChIKey | GFLYSDRDWZPZRC-UHFFFAOYSA-M |
| XLogP | -2.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.45 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 101453034 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101453034?
The IUPAC name of CID 101453034 (CID 101453034) is not available.
What is the SMILES notation for CID 101453034?
The canonical SMILES for CID 101453034 is [Br-].[CH2]CCN(C)C.[Zn].
What is the InChIKey of CID 101453034?
The InChIKey is GFLYSDRDWZPZRC-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H12N.BrH.Zn/c1-4-5-6(2)3;;/h1,4-5H2,2-3H3;1H;/p-1.
What are the key properties of CID 101453034?
CID 101453034 has a molecular weight of 231.45 g/mol, XLogP of -2.23, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101453034 is sourced from PubChem (CID 101453034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).