C29H29F2N5O7 — CID 10145317
6-[4-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]-7-fluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid (PubChem CID 10145317) has the molecular formula C29H29F2N5O7 and a molecular weight of 597.58 g/mol. Its IUPAC name is 6-[4-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]-7-fluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid.
| Compound Name | 6-[4-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]-7-fluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid |
|---|---|
| PubChem CID | 10145317 |
| Molecular Formula | C29H29F2N5O7 |
| Molecular Weight | 597.58 g/mol |
| Exact Mass | 597.20 |
| IUPAC Name | 6-[4-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]-7-fluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid |
| SMILES | CC(=O)NCC1CN(c2ccc(N3CCN(c4c(F)cc5c(=O)c(C(=O)O)cn6c5c4OCC6C)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C29H29F2N5O7/c1-15-14-42-27-24-19(26(38)20(28(39)40)13-35(15)24)10-22(31)25(27)34-7-5-33(6-8-34)23-4-3-17(9-21(23)30)36-12-18(43-29(36)41)11-32-16(2)37/h3-4,9-10,13,15,18H,5-8,11-12,14H2,1-2H3,(H,32,37)(H,39,40) |
| InChIKey | SKQNBBKLALGGCZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 133.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.58 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|