C19H11F9O4S — CID 101453503
[2-[(E)-3-phenylprop-2-enoyl]phenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 101453503) has the molecular formula C19H11F9O4S and a molecular weight of 506.34 g/mol. Its IUPAC name is [2-[(E)-3-phenylprop-2-enoyl]phenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [2-[(E)-3-phenylprop-2-enoyl]phenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 101453503 |
| Molecular Formula | C19H11F9O4S |
| Molecular Weight | 506.34 g/mol |
| Exact Mass | 506.02 |
| IUPAC Name | [2-[(E)-3-phenylprop-2-enoyl]phenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | O=C(/C=C/c1ccccc1)c1ccccc1OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H11F9O4S/c20-16(21,18(24,25)26)17(22,23)19(27,28)33(30,31)32-15-9-5-4-8-13(15)14(29)11-10-12-6-2-1-3-7-12/h1-11H/b11-10+ |
| InChIKey | PFKOJMDQCTZFGT-ZHACJKMWSA-N |
| XLogP | 5.72 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.34 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|