C45H54O6Si — CID 101453594
(2R,3R,5R,6aR,7S,10aS)-7-[(1S,5S)-5-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyhexyl]-5-methoxy-2,3-diphenyl-3,5,6,6a,7,10a-hexahydro-2H-1,4-benzodioxocin-8-one (PubChem CID 101453594) has the molecular formula C45H54O6Si and a molecular weight of 719.01 g/mol. Its IUPAC name is (2R,3R,5R,6aR,7S,10aS)-7-[(1S,5S)-5-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyhexyl]-5-methoxy-2,3-diphenyl-3,5,6,6a,7,10a-hexahydro-2H-1,4-benzodioxocin-8-one.
| Compound Name | (2R,3R,5R,6aR,7S,10aS)-7-[(1S,5S)-5-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyhexyl]-5-methoxy-2,3-diphenyl-3,5,6,6a,7,10a-hexahydro-2H-1,4-benzodioxocin-8-one |
|---|---|
| PubChem CID | 101453594 |
| Molecular Formula | C45H54O6Si |
| Molecular Weight | 719.01 g/mol |
| Exact Mass | 718.37 |
| IUPAC Name | (2R,3R,5R,6aR,7S,10aS)-7-[(1S,5S)-5-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyhexyl]-5-methoxy-2,3-diphenyl-3,5,6,6a,7,10a-hexahydro-2H-1,4-benzodioxocin-8-one |
| SMILES | CO[C@H]1C[C@@H]2[C@@H]([C@@H](O)CCC[C@H](C)O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C(=O)C=C[C@@H]2O[C@H](c2ccccc2)[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C45H54O6Si/c1-32(51-52(45(2,3)4,35-24-14-8-15-25-35)36-26-16-9-17-27-36)19-18-28-38(46)42-37-31-41(48-5)50-44(34-22-12-7-13-23-34)43(33-20-10-6-11-21-33)49-40(37)30-29-39(42)47/h6-17,20-27,29-30,32,37-38,40-44,46H,18-19,28,31H2,1-5H3/t32-,37-,38-,40-,41+,42-,43+,44+/m0/s1 |
| InChIKey | RVJAHTWBVIXVDJ-ILMLMFSXSA-N |
| XLogP | 8.11 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.01 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|