C15H13F2N — CID 101453928
N-benzyl-1-(3,6-difluoro-2-methylphenyl)methanimine (PubChem CID 101453928) has the molecular formula C15H13F2N and a molecular weight of 245.27 g/mol. Its IUPAC name is N-benzyl-1-(3,6-difluoro-2-methylphenyl)methanimine.
| Compound Name | N-benzyl-1-(3,6-difluoro-2-methylphenyl)methanimine |
|---|---|
| PubChem CID | 101453928 |
| Molecular Formula | C15H13F2N |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | N-benzyl-1-(3,6-difluoro-2-methylphenyl)methanimine |
| SMILES | Cc1c(F)ccc(F)c1/C=N/Cc1ccccc1 |
| InChI | InChI=1S/C15H13F2N/c1-11-13(15(17)8-7-14(11)16)10-18-9-12-5-3-2-4-6-12/h2-8,10H,9H2,1H3/b18-10+ |
| InChIKey | PGMCGZJIKGDHPP-VCHYOVAHSA-N |
| XLogP | 3.89 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|