C29H29N3O5 — CID 101454056
1-benzyl-2-N,4-N-bis(4-methoxyphenyl)-2,5-dimethyl-3-oxopyrrole-2,4-dicarboxamide (PubChem CID 101454056) has the molecular formula C29H29N3O5 and a molecular weight of 499.57 g/mol. Its IUPAC name is 1-benzyl-2-N,4-N-bis(4-methoxyphenyl)-2,5-dimethyl-3-oxopyrrole-2,4-dicarboxamide.
| Compound Name | 1-benzyl-2-N,4-N-bis(4-methoxyphenyl)-2,5-dimethyl-3-oxopyrrole-2,4-dicarboxamide |
|---|---|
| PubChem CID | 101454056 |
| Molecular Formula | C29H29N3O5 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | 1-benzyl-2-N,4-N-bis(4-methoxyphenyl)-2,5-dimethyl-3-oxopyrrole-2,4-dicarboxamide |
| SMILES | COc1ccc(NC(=O)C2=C(C)N(Cc3ccccc3)C(C)(C(=O)Nc3ccc(OC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C29H29N3O5/c1-19-25(27(34)30-21-10-14-23(36-3)15-11-21)26(33)29(2,32(19)18-20-8-6-5-7-9-20)28(35)31-22-12-16-24(37-4)17-13-22/h5-17H,18H2,1-4H3,(H,30,34)(H,31,35) |
| InChIKey | YUHWGQMTFVQDBC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|