C31H32N4O7S — CID 10145484
(4S,5S,6R)-4-(dimethylamino)-3,5,10,11-tetrahydroxy-6-methyl-1,12-dioxo-9-[(4-phenyl-1,3-thiazol-2-yl)amino]-2,3,4,4a,5,5a,6,12a-octahydrotetracene-2-carboxamide (PubChem CID 10145484) has the molecular formula C31H32N4O7S and a molecular weight of 604.69 g/mol. Its IUPAC name is (4S,5S,6R)-4-(dimethylamino)-3,5,10,11-tetrahydroxy-6-methyl-1,12-dioxo-9-[(4-phenyl-1,3-thiazol-2-yl)amino]-2,3,4,4a,5,5a,6,12a-octahydrotetracene-2-carboxamide.
| Compound Name | (4S,5S,6R)-4-(dimethylamino)-3,5,10,11-tetrahydroxy-6-methyl-1,12-dioxo-9-[(4-phenyl-1,3-thiazol-2-yl)amino]-2,3,4,4a,5,5a,6,12a-octahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 10145484 |
| Molecular Formula | C31H32N4O7S |
| Molecular Weight | 604.69 g/mol |
| Exact Mass | 604.20 |
| IUPAC Name | (4S,5S,6R)-4-(dimethylamino)-3,5,10,11-tetrahydroxy-6-methyl-1,12-dioxo-9-[(4-phenyl-1,3-thiazol-2-yl)amino]-2,3,4,4a,5,5a,6,12a-octahydrotetracene-2-carboxamide |
| SMILES | C[C@H]1c2ccc(Nc3nc(-c4ccccc4)cs3)c(O)c2C(O)=C2C(=O)C3C(=O)C(C(N)=O)C(O)C(N(C)C)C3[C@@H](O)C21 |
| InChI | InChI=1S/C31H32N4O7S/c1-12-14-9-10-15(33-31-34-16(11-43-31)13-7-5-4-6-8-13)24(36)18(14)26(38)20-17(12)25(37)19-21(27(20)39)28(40)22(30(32)42)29(41)23(19)35(2)3/h4-12,17,19,21-23,25,29,36-38,41H,1-3H3,(H2,32,42)(H,33,34)/t12-,17?,19?,21?,22?,23?,25-,29?/m0/s1 |
| InChIKey | CBOAUEZOAWRMSW-VESDOAHZSA-N |
| XLogP | 2.41 |
| TPSA | 186.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.69 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|