C36H39NO5Si — CID 101454855
(1S,4S,5R)-6-[(3,4-dimethoxyphenyl)methyl]-1-trimethylsilyl-4-(trityloxymethyl)-3-oxa-6-azabicyclo[3.1.0]hexan-2-one (PubChem CID 101454855) has the molecular formula C36H39NO5Si and a molecular weight of 593.80 g/mol. Its IUPAC name is (1S,4S,5R)-6-[(3,4-dimethoxyphenyl)methyl]-1-trimethylsilyl-4-(trityloxymethyl)-3-oxa-6-azabicyclo[3.1.0]hexan-2-one.
| Compound Name | (1S,4S,5R)-6-[(3,4-dimethoxyphenyl)methyl]-1-trimethylsilyl-4-(trityloxymethyl)-3-oxa-6-azabicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 101454855 |
| Molecular Formula | C36H39NO5Si |
| Molecular Weight | 593.80 g/mol |
| Exact Mass | 593.26 |
| IUPAC Name | (1S,4S,5R)-6-[(3,4-dimethoxyphenyl)methyl]-1-trimethylsilyl-4-(trityloxymethyl)-3-oxa-6-azabicyclo[3.1.0]hexan-2-one |
| SMILES | COc1ccc(CN2[C@@H]3[C@@H](COC(c4ccccc4)(c4ccccc4)c4ccccc4)OC(=O)[C@@]32[Si](C)(C)C)cc1OC |
| InChI | InChI=1S/C36H39NO5Si/c1-39-30-22-21-26(23-31(30)40-2)24-37-33-32(42-34(38)36(33,37)43(3,4)5)25-41-35(27-15-9-6-10-16-27,28-17-11-7-12-18-28)29-19-13-8-14-20-29/h6-23,32-33H,24-25H2,1-5H3/t32-,33-,36+,37?/m1/s1 |
| InChIKey | NJYFYNZORKELPF-DWOKWBKJSA-N |
| XLogP | 6.44 |
| TPSA | 57.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.80 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|