About methyl 2-(9b-hydroxy-5-oxo-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-1-yl)acetate
methyl 2-(9b-hydroxy-5-oxo-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-1-yl)acetate (PubChem CID 101455240) has the molecular formula C14H15NO4
and a molecular weight of 261.28 g/mol. Its IUPAC name is methyl 2-(9b-hydroxy-5-oxo-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-1-yl)acetate.
Molecular Properties
| Compound Name | methyl 2-(9b-hydroxy-5-oxo-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-1-yl)acetate |
| PubChem CID | 101455240 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | methyl 2-(9b-hydroxy-5-oxo-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-1-yl)acetate |
| SMILES | COC(=O)CC1CCN2C(=O)c3ccccc3C12O |
| InChI | InChI=1S/C14H15NO4/c1-19-12(16)8-9-6-7-15-13(17)10-4-2-3-5-11(10)14(9,15)18/h2-5,9,18H,6-8H2,1H3 |
| InChIKey | MANDLICFZCPMOM-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-(9b-hydroxy-5-oxo-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(9b-hydroxy-5-oxo-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-1-yl)acetate?
The IUPAC name of methyl 2-(9b-hydroxy-5-oxo-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-1-yl)acetate (CID 101455240) is methyl 2-(9b-hydroxy-5-oxo-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-1-yl)acetate.
What is the SMILES notation for methyl 2-(9b-hydroxy-5-oxo-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-1-yl)acetate?
The canonical SMILES for methyl 2-(9b-hydroxy-5-oxo-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-1-yl)acetate is COC(=O)CC1CCN2C(=O)c3ccccc3C12O.
What is the InChIKey of methyl 2-(9b-hydroxy-5-oxo-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-1-yl)acetate?
The InChIKey is MANDLICFZCPMOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO4/c1-19-12(16)8-9-6-7-15-13(17)10-4-2-3-5-11(10)14(9,15)18/h2-5,9,18H,6-8H2,1H3.
What are the key properties of methyl 2-(9b-hydroxy-5-oxo-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-1-yl)acetate?
methyl 2-(9b-hydroxy-5-oxo-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-1-yl)acetate has a molecular weight of 261.28 g/mol, XLogP of 0.87, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(9b-hydroxy-5-oxo-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-1-yl)acetate is sourced from PubChem (CID 101455240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).