C31H40O5SSi — CID 101455851
tert-butyl-diphenyl-[[(2R,3R,4S,5R,6R)-3,4,5-trimethoxy-6-phenylsulfanyloxan-2-yl]methoxy]silane (PubChem CID 101455851) has the molecular formula C31H40O5SSi and a molecular weight of 552.81 g/mol. Its IUPAC name is tert-butyl-diphenyl-[[(2R,3R,4S,5R,6R)-3,4,5-trimethoxy-6-phenylsulfanyloxan-2-yl]methoxy]silane.
| Compound Name | tert-butyl-diphenyl-[[(2R,3R,4S,5R,6R)-3,4,5-trimethoxy-6-phenylsulfanyloxan-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 101455851 |
| Molecular Formula | C31H40O5SSi |
| Molecular Weight | 552.81 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | tert-butyl-diphenyl-[[(2R,3R,4S,5R,6R)-3,4,5-trimethoxy-6-phenylsulfanyloxan-2-yl]methoxy]silane |
| SMILES | CO[C@@H]1[C@@H](OC)[C@@H](Sc2ccccc2)O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]1OC |
| InChI | InChI=1S/C31H40O5SSi/c1-31(2,3)38(24-18-12-8-13-19-24,25-20-14-9-15-21-25)35-22-26-27(32-4)28(33-5)29(34-6)30(36-26)37-23-16-10-7-11-17-23/h7-21,26-30H,22H2,1-6H3/t26-,27-,28+,29-,30-/m1/s1 |
| InChIKey | QMXQPHKTRPBLHP-CMPUJJQDSA-N |
| XLogP | 5.13 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.81 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|