C31H33N7O5 — CID 101455863
2-[2-(2-methoxyethoxy)ethoxy]ethyl 2,6-bis[1-(4-methylphenyl)triazol-4-yl]pyridine-4-carboxylate (PubChem CID 101455863) has the molecular formula C31H33N7O5 and a molecular weight of 583.65 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2,6-bis[1-(4-methylphenyl)triazol-4-yl]pyridine-4-carboxylate.
| Compound Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2,6-bis[1-(4-methylphenyl)triazol-4-yl]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 101455863 |
| Molecular Formula | C31H33N7O5 |
| Molecular Weight | 583.65 g/mol |
| Exact Mass | 583.25 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2,6-bis[1-(4-methylphenyl)triazol-4-yl]pyridine-4-carboxylate |
| SMILES | COCCOCCOCCOC(=O)c1cc(-c2cn(-c3ccc(C)cc3)nn2)nc(-c2cn(-c3ccc(C)cc3)nn2)c1 |
| InChI | InChI=1S/C31H33N7O5/c1-22-4-8-25(9-5-22)37-20-29(33-35-37)27-18-24(31(39)43-17-16-42-15-14-41-13-12-40-3)19-28(32-27)30-21-38(36-34-30)26-10-6-23(2)7-11-26/h4-11,18-21H,12-17H2,1-3H3 |
| InChIKey | OVLGIPAOGSVYSE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 128.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.65 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|