C13H18O3 — CID 101456226
(3R,5R,6S)-3,5-dimethyl-6-[(2E)-4-methylpenta-2,4-dien-2-yl]oxane-2,4-dione (PubChem CID 101456226) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is (3R,5R,6S)-3,5-dimethyl-6-[(2E)-4-methylpenta-2,4-dien-2-yl]oxane-2,4-dione.
| Compound Name | (3R,5R,6S)-3,5-dimethyl-6-[(2E)-4-methylpenta-2,4-dien-2-yl]oxane-2,4-dione |
|---|---|
| PubChem CID | 101456226 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (3R,5R,6S)-3,5-dimethyl-6-[(2E)-4-methylpenta-2,4-dien-2-yl]oxane-2,4-dione |
| SMILES | C=C(C)/C=C(\C)[C@H]1OC(=O)[C@H](C)C(=O)[C@@H]1C |
| InChI | InChI=1S/C13H18O3/c1-7(2)6-8(3)12-9(4)11(14)10(5)13(15)16-12/h6,9-10,12H,1H2,2-5H3/b8-6+/t9-,10+,12+/m0/s1 |
| InChIKey | VVEDUKHBUSEKEK-VHWSJSKASA-N |
| XLogP | 2.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|