C13H16O4 — CID 101456234
(E)-2-methyl-3-[(1S,4S,6R,7S)-4,6,7-trimethyl-3,5-dioxo-2-oxabicyclo[2.2.1]heptan-7-yl]prop-2-enal (PubChem CID 101456234) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is (E)-2-methyl-3-[(1S,4S,6R,7S)-4,6,7-trimethyl-3,5-dioxo-2-oxabicyclo[2.2.1]heptan-7-yl]prop-2-enal.
| Compound Name | (E)-2-methyl-3-[(1S,4S,6R,7S)-4,6,7-trimethyl-3,5-dioxo-2-oxabicyclo[2.2.1]heptan-7-yl]prop-2-enal |
|---|---|
| PubChem CID | 101456234 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (E)-2-methyl-3-[(1S,4S,6R,7S)-4,6,7-trimethyl-3,5-dioxo-2-oxabicyclo[2.2.1]heptan-7-yl]prop-2-enal |
| SMILES | C/C(C=O)=C\[C@]1(C)[C@H]2OC(=O)[C@]1(C)C(=O)[C@@H]2C |
| InChI | InChI=1S/C13H16O4/c1-7(6-14)5-12(3)10-8(2)9(15)13(12,4)11(16)17-10/h5-6,8,10H,1-4H3/b7-5+/t8-,10-,12+,13-/m0/s1 |
| InChIKey | CUYWPEYQYWYUOH-HWZVTXGHSA-N |
| XLogP | 1.29 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|