C17H28OSi — CID 101456329
trans-(1R,2R)-2-[3-[tert-butyl(dimethyl)silyl]prop-2-ynyl]-1-propa-1,2-dienylcyclopentan-1-ol (PubChem CID 101456329) has the molecular formula C17H28OSi and a molecular weight of 276.50 g/mol. Its IUPAC name is trans-(1R,2R)-2-[3-[tert-butyl(dimethyl)silyl]prop-2-ynyl]-1-propa-1,2-dienylcyclopentan-1-ol.
| Compound Name | trans-(1R,2R)-2-[3-[tert-butyl(dimethyl)silyl]prop-2-ynyl]-1-propa-1,2-dienylcyclopentan-1-ol |
|---|---|
| PubChem CID | 101456329 |
| Molecular Formula | C17H28OSi |
| Molecular Weight | 276.50 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | trans-(1R,2R)-2-[3-[tert-butyl(dimethyl)silyl]prop-2-ynyl]-1-propa-1,2-dienylcyclopentan-1-ol |
| SMILES | C=C=C[C@@]1(O)CCC[C@@H]1CC#C[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H28OSi/c1-7-12-17(18)13-8-10-15(17)11-9-14-19(5,6)16(2,3)4/h12,15,18H,1,8,10-11,13H2,2-6H3/t15-,17-/m1/s1 |
| InChIKey | RZPCTFMVBIIVKA-NVXWUHKLSA-N |
| XLogP | 4.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|