C28H23F7N2O4S — CID 10145681
1-[5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-1,3-thiazol-2-yl]-1-(4-ethylphenyl)-2,2,2-trifluoroethanol (PubChem CID 10145681) has the molecular formula C28H23F7N2O4S and a molecular weight of 616.56 g/mol. Its IUPAC name is 1-[5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-1,3-thiazol-2-yl]-1-(4-ethylphenyl)-2,2,2-trifluoroethanol.
| Compound Name | 1-[5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-1,3-thiazol-2-yl]-1-(4-ethylphenyl)-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 10145681 |
| Molecular Formula | C28H23F7N2O4S |
| Molecular Weight | 616.56 g/mol |
| Exact Mass | 616.13 |
| IUPAC Name | 1-[5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-1,3-thiazol-2-yl]-1-(4-ethylphenyl)-2,2,2-trifluoroethanol |
| SMILES | CCc1ccc(C(O)(c2ncc(C(Cc3cc[n+]([O-])cc3)c3ccc(OC(F)F)c(OC(F)F)c3)s2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C28H23F7N2O4S/c1-2-16-3-6-19(7-4-16)27(38,28(33,34)35)24-36-15-23(42-24)20(13-17-9-11-37(39)12-10-17)18-5-8-21(40-25(29)30)22(14-18)41-26(31)32/h3-12,14-15,20,25-26,38H,2,13H2,1H3 |
| InChIKey | HNEANZLMIRJFSH-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.56 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|