About (7,7-dimethoxy-6-oxoheptyl) acetate
(7,7-dimethoxy-6-oxoheptyl) acetate (PubChem CID 101457017) has the molecular formula C11H20O5
and a molecular weight of 232.28 g/mol. Its IUPAC name is (7,7-dimethoxy-6-oxoheptyl) acetate.
Molecular Properties
| Compound Name | (7,7-dimethoxy-6-oxoheptyl) acetate |
| PubChem CID | 101457017 |
| Molecular Formula | C11H20O5 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | (7,7-dimethoxy-6-oxoheptyl) acetate |
| SMILES | COC(OC)C(=O)CCCCCOC(C)=O |
| InChI | InChI=1S/C11H20O5/c1-9(12)16-8-6-4-5-7-10(13)11(14-2)15-3/h11H,4-8H2,1-3H3 |
| InChIKey | REZVZEVPRRGGEO-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (7,7-dimethoxy-6-oxoheptyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7,7-dimethoxy-6-oxoheptyl) acetate?
The IUPAC name of (7,7-dimethoxy-6-oxoheptyl) acetate (CID 101457017) is (7,7-dimethoxy-6-oxoheptyl) acetate.
What is the SMILES notation for (7,7-dimethoxy-6-oxoheptyl) acetate?
The canonical SMILES for (7,7-dimethoxy-6-oxoheptyl) acetate is COC(OC)C(=O)CCCCCOC(C)=O.
What is the InChIKey of (7,7-dimethoxy-6-oxoheptyl) acetate?
The InChIKey is REZVZEVPRRGGEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O5/c1-9(12)16-8-6-4-5-7-10(13)11(14-2)15-3/h11H,4-8H2,1-3H3.
What are the key properties of (7,7-dimethoxy-6-oxoheptyl) acetate?
(7,7-dimethoxy-6-oxoheptyl) acetate has a molecular weight of 232.28 g/mol, XLogP of 1.30, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (7,7-dimethoxy-6-oxoheptyl) acetate is sourced from PubChem (CID 101457017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).