About [(2R)-2-tert-butyl-1,1-bis(trimethylsilyl)-2-trimethylsilyloxysilet-3-yl]-trimethylsilane
[(2R)-2-tert-butyl-1,1-bis(trimethylsilyl)-2-trimethylsilyloxysilet-3-yl]-trimethylsilane (PubChem CID 101457050) has the molecular formula C19H46OSi5
and a molecular weight of 431.01 g/mol. Its IUPAC name is [(2R)-2-tert-butyl-1,1-bis(trimethylsilyl)-2-trimethylsilyloxysilet-3-yl]-trimethylsilane.
Molecular Properties
| Compound Name | [(2R)-2-tert-butyl-1,1-bis(trimethylsilyl)-2-trimethylsilyloxysilet-3-yl]-trimethylsilane |
| PubChem CID | 101457050 |
| Molecular Formula | C19H46OSi5 |
| Molecular Weight | 431.01 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | [(2R)-2-tert-butyl-1,1-bis(trimethylsilyl)-2-trimethylsilyloxysilet-3-yl]-trimethylsilane |
| SMILES | CC(C)(C)[C@]1(O[Si](C)(C)C)C([Si](C)(C)C)=C[Si]1([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C19H46OSi5/c1-18(2,3)19(20-22(7,8)9)17(21(4,5)6)16-25(19,23(10,11)12)24(13,14)15/h16H,1-15H3/t19-/m0/s1 |
| InChIKey | VMQRCZSPTNYKCC-IBGZPJMESA-N |
| XLogP | 6.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.01 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-2-tert-butyl-1,1-bis(trimethylsilyl)-2-trimethylsilyloxysilet-3-yl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2-tert-butyl-1,1-bis(trimethylsilyl)-2-trimethylsilyloxysilet-3-yl]-trimethylsilane?
The IUPAC name of [(2R)-2-tert-butyl-1,1-bis(trimethylsilyl)-2-trimethylsilyloxysilet-3-yl]-trimethylsilane (CID 101457050) is [(2R)-2-tert-butyl-1,1-bis(trimethylsilyl)-2-trimethylsilyloxysilet-3-yl]-trimethylsilane.
What is the SMILES notation for [(2R)-2-tert-butyl-1,1-bis(trimethylsilyl)-2-trimethylsilyloxysilet-3-yl]-trimethylsilane?
The canonical SMILES for [(2R)-2-tert-butyl-1,1-bis(trimethylsilyl)-2-trimethylsilyloxysilet-3-yl]-trimethylsilane is CC(C)(C)[C@]1(O[Si](C)(C)C)C([Si](C)(C)C)=C[Si]1([Si](C)(C)C)[Si](C)(C)C.
What is the InChIKey of [(2R)-2-tert-butyl-1,1-bis(trimethylsilyl)-2-trimethylsilyloxysilet-3-yl]-trimethylsilane?
The InChIKey is VMQRCZSPTNYKCC-IBGZPJMESA-N. The full InChI is InChI=1S/C19H46OSi5/c1-18(2,3)19(20-22(7,8)9)17(21(4,5)6)16-25(19,23(10,11)12)24(13,14)15/h16H,1-15H3/t19-/m0/s1.
What are the key properties of [(2R)-2-tert-butyl-1,1-bis(trimethylsilyl)-2-trimethylsilyloxysilet-3-yl]-trimethylsilane?
[(2R)-2-tert-butyl-1,1-bis(trimethylsilyl)-2-trimethylsilyloxysilet-3-yl]-trimethylsilane has a molecular weight of 431.01 g/mol, XLogP of 6.80, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2-tert-butyl-1,1-bis(trimethylsilyl)-2-trimethylsilyloxysilet-3-yl]-trimethylsilane is sourced from PubChem (CID 101457050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).