C17H16O7 — CID 101457422
methyl (1S,9R)-5,5-dimethyl-3-oxo-4,6,8,10-tetraoxatetracyclo[7.7.1.02,7.011,16]heptadeca-2(7),11,13,15-tetraene-17-carboxylate (PubChem CID 101457422) has the molecular formula C17H16O7 and a molecular weight of 332.31 g/mol. Its IUPAC name is methyl (1S,9R)-5,5-dimethyl-3-oxo-4,6,8,10-tetraoxatetracyclo[7.7.1.02,7.011,16]heptadeca-2(7),11,13,15-tetraene-17-carboxylate.
| Compound Name | methyl (1S,9R)-5,5-dimethyl-3-oxo-4,6,8,10-tetraoxatetracyclo[7.7.1.02,7.011,16]heptadeca-2(7),11,13,15-tetraene-17-carboxylate |
|---|---|
| PubChem CID | 101457422 |
| Molecular Formula | C17H16O7 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | methyl (1S,9R)-5,5-dimethyl-3-oxo-4,6,8,10-tetraoxatetracyclo[7.7.1.02,7.011,16]heptadeca-2(7),11,13,15-tetraene-17-carboxylate |
| SMILES | COC(=O)C1[C@H]2OC3=C(C(=O)OC(C)(C)O3)[C@@H]1c1ccccc1O2 |
| InChI | InChI=1S/C17H16O7/c1-17(2)23-14(19)12-10-8-6-4-5-7-9(8)21-15(22-16(12)24-17)11(10)13(18)20-3/h4-7,10-11,15H,1-3H3/t10-,11?,15-/m1/s1 |
| InChIKey | OGAWAPLBHZZBEW-MKOUYDOKSA-N |
| XLogP | 1.83 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |