C13H19N5O3 — CID 101457516
4-(butylamino)-2,6,8-trimethylpyrimido[4,5-c]pyridazine-3,5,7-trione (PubChem CID 101457516) has the molecular formula C13H19N5O3 and a molecular weight of 293.33 g/mol. Its IUPAC name is 4-(butylamino)-2,6,8-trimethylpyrimido[4,5-c]pyridazine-3,5,7-trione.
| Compound Name | 4-(butylamino)-2,6,8-trimethylpyrimido[4,5-c]pyridazine-3,5,7-trione |
|---|---|
| PubChem CID | 101457516 |
| Molecular Formula | C13H19N5O3 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 4-(butylamino)-2,6,8-trimethylpyrimido[4,5-c]pyridazine-3,5,7-trione |
| SMILES | CCCCNc1c(=O)n(C)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C13H19N5O3/c1-5-6-7-14-9-8-10(15-18(4)12(9)20)16(2)13(21)17(3)11(8)19/h14H,5-7H2,1-4H3 |
| InChIKey | VFBWHFHWPKTRIC-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|