C19H26O6 — CID 101457615
[(3E)-4-[(4S,5S)-2,2-dimethyl-5-(3-methyl-2-oxobut-3-enyl)-1,3-dioxolan-4-yl]-3-methylbuta-1,3-dien-2-yl] prop-2-enyl carbonate (PubChem CID 101457615) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is [(3E)-4-[(4S,5S)-2,2-dimethyl-5-(3-methyl-2-oxobut-3-enyl)-1,3-dioxolan-4-yl]-3-methylbuta-1,3-dien-2-yl] prop-2-enyl carbonate.
| Compound Name | [(3E)-4-[(4S,5S)-2,2-dimethyl-5-(3-methyl-2-oxobut-3-enyl)-1,3-dioxolan-4-yl]-3-methylbuta-1,3-dien-2-yl] prop-2-enyl carbonate |
|---|---|
| PubChem CID | 101457615 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | [(3E)-4-[(4S,5S)-2,2-dimethyl-5-(3-methyl-2-oxobut-3-enyl)-1,3-dioxolan-4-yl]-3-methylbuta-1,3-dien-2-yl] prop-2-enyl carbonate |
| SMILES | C=CCOC(=O)OC(=C)/C(C)=C/[C@@H]1OC(C)(C)O[C@H]1CC(=O)C(=C)C |
| InChI | InChI=1S/C19H26O6/c1-8-9-22-18(21)23-14(5)13(4)10-16-17(11-15(20)12(2)3)25-19(6,7)24-16/h8,10,16-17H,1-2,5,9,11H2,3-4,6-7H3/b13-10+/t16-,17-/m0/s1 |
| InChIKey | BAZWTLPQULACJN-HTSSDKKRSA-N |
| XLogP | 3.84 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|