About 2-butyl-6,7-dichloro-4-methylsulfanyl-1H-indole-5-carbonitrile
2-butyl-6,7-dichloro-4-methylsulfanyl-1H-indole-5-carbonitrile (PubChem CID 101457767) has the molecular formula C14H14Cl2N2S
and a molecular weight of 313.25 g/mol. Its IUPAC name is 2-butyl-6,7-dichloro-4-methylsulfanyl-1H-indole-5-carbonitrile.
Molecular Properties
| Compound Name | 2-butyl-6,7-dichloro-4-methylsulfanyl-1H-indole-5-carbonitrile |
| PubChem CID | 101457767 |
| Molecular Formula | C14H14Cl2N2S |
| Molecular Weight | 313.25 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 2-butyl-6,7-dichloro-4-methylsulfanyl-1H-indole-5-carbonitrile |
| SMILES | CCCCc1cc2c(SC)c(C#N)c(Cl)c(Cl)c2[nH]1 |
| InChI | InChI=1S/C14H14Cl2N2S/c1-3-4-5-8-6-9-13(18-8)12(16)11(15)10(7-17)14(9)19-2/h6,18H,3-5H2,1-2H3 |
| InChIKey | FMAULWSSQKMLDL-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 39.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 313.25 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butyl-6,7-dichloro-4-methylsulfanyl-1H-indole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-6,7-dichloro-4-methylsulfanyl-1H-indole-5-carbonitrile?
The IUPAC name of 2-butyl-6,7-dichloro-4-methylsulfanyl-1H-indole-5-carbonitrile (CID 101457767) is 2-butyl-6,7-dichloro-4-methylsulfanyl-1H-indole-5-carbonitrile.
What is the SMILES notation for 2-butyl-6,7-dichloro-4-methylsulfanyl-1H-indole-5-carbonitrile?
The canonical SMILES for 2-butyl-6,7-dichloro-4-methylsulfanyl-1H-indole-5-carbonitrile is CCCCc1cc2c(SC)c(C#N)c(Cl)c(Cl)c2[nH]1.
What is the InChIKey of 2-butyl-6,7-dichloro-4-methylsulfanyl-1H-indole-5-carbonitrile?
The InChIKey is FMAULWSSQKMLDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14Cl2N2S/c1-3-4-5-8-6-9-13(18-8)12(16)11(15)10(7-17)14(9)19-2/h6,18H,3-5H2,1-2H3.
What are the key properties of 2-butyl-6,7-dichloro-4-methylsulfanyl-1H-indole-5-carbonitrile?
2-butyl-6,7-dichloro-4-methylsulfanyl-1H-indole-5-carbonitrile has a molecular weight of 313.25 g/mol, XLogP of 5.41, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-6,7-dichloro-4-methylsulfanyl-1H-indole-5-carbonitrile is sourced from PubChem (CID 101457767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).