C39H34BF10OP — CID 101457930
2-bis(2,4,6-trimethylphenyl)phosphaniumylethyl-bis(2,3,4,5,6-pentafluorophenyl)-phenylmethoxyboranuide (PubChem CID 101457930) has the molecular formula C39H34BF10OP and a molecular weight of 750.47 g/mol. Its IUPAC name is 2-bis(2,4,6-trimethylphenyl)phosphaniumylethyl-bis(2,3,4,5,6-pentafluorophenyl)-phenylmethoxyboranuide.
| Compound Name | 2-bis(2,4,6-trimethylphenyl)phosphaniumylethyl-bis(2,3,4,5,6-pentafluorophenyl)-phenylmethoxyboranuide |
|---|---|
| PubChem CID | 101457930 |
| Molecular Formula | C39H34BF10OP |
| Molecular Weight | 750.47 g/mol |
| Exact Mass | 750.23 |
| IUPAC Name | 2-bis(2,4,6-trimethylphenyl)phosphaniumylethyl-bis(2,3,4,5,6-pentafluorophenyl)-phenylmethoxyboranuide |
| SMILES | Cc1cc(C)c([PH+](CC[B-](OCc2ccccc2)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C39H33BF10OP/c1-19-14-21(3)38(22(4)15-19)52(39-23(5)16-20(2)17-24(39)6)13-12-40(51-18-25-10-8-7-9-11-25,26-28(41)32(45)36(49)33(46)29(26)42)27-30(43)34(47)37(50)35(48)31(27)44/h7-11,14-17H,12-13,18H2,1-6H3/q-1/p+1 |
| InChIKey | QUMTYAILQOGULP-UHFFFAOYSA-O |
| XLogP | 9.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.47 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|