C15H13F3N2O2 — CID 101458240
N-[(4aS,9bR)-4-cyano-2,3,4,9b-tetrahydro-1H-dibenzofuran-4a-yl]-2,2,2-trifluoroacetamide (PubChem CID 101458240) has the molecular formula C15H13F3N2O2 and a molecular weight of 310.28 g/mol. Its IUPAC name is N-[(4aS,9bR)-4-cyano-2,3,4,9b-tetrahydro-1H-dibenzofuran-4a-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(4aS,9bR)-4-cyano-2,3,4,9b-tetrahydro-1H-dibenzofuran-4a-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 101458240 |
| Molecular Formula | C15H13F3N2O2 |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | N-[(4aS,9bR)-4-cyano-2,3,4,9b-tetrahydro-1H-dibenzofuran-4a-yl]-2,2,2-trifluoroacetamide |
| SMILES | N#CC1CCC[C@@H]2c3ccccc3O[C@]12NC(=O)C(F)(F)F |
| InChI | InChI=1S/C15H13F3N2O2/c16-15(17,18)13(21)20-14-9(8-19)4-3-6-11(14)10-5-1-2-7-12(10)22-14/h1-2,5,7,9,11H,3-4,6H2,(H,20,21)/t9?,11-,14-/m1/s1 |
| InChIKey | CFSIRYJZSZIJOV-ZZNDMADYSA-N |
| XLogP | 2.86 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |