About 2-ethoxyethyl (E)-3-[(2-bromo-1,3-thiazol-5-yl)methylamino]-2-cyano-4-methylpent-2-enoate
2-ethoxyethyl (E)-3-[(2-bromo-1,3-thiazol-5-yl)methylamino]-2-cyano-4-methylpent-2-enoate (PubChem CID 101458297) has the molecular formula C15H20BrN3O3S
and a molecular weight of 402.31 g/mol. Its IUPAC name is 2-ethoxyethyl (E)-3-[(2-bromo-1,3-thiazol-5-yl)methylamino]-2-cyano-4-methylpent-2-enoate.
Molecular Properties
| Compound Name | 2-ethoxyethyl (E)-3-[(2-bromo-1,3-thiazol-5-yl)methylamino]-2-cyano-4-methylpent-2-enoate |
| PubChem CID | 101458297 |
| Molecular Formula | C15H20BrN3O3S |
| Molecular Weight | 402.31 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 2-ethoxyethyl (E)-3-[(2-bromo-1,3-thiazol-5-yl)methylamino]-2-cyano-4-methylpent-2-enoate |
| SMILES | CCOCCOC(=O)/C(C#N)=C(/NCc1cnc(Br)s1)C(C)C |
| InChI | InChI=1S/C15H20BrN3O3S/c1-4-21-5-6-22-14(20)12(7-17)13(10(2)3)18-8-11-9-19-15(16)23-11/h9-10,18H,4-6,8H2,1-3H3/b13-12+ |
| InChIKey | RBHZNOYCNLDBKC-OUKQBFOZSA-N |
| XLogP | 3.01 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxyethyl (E)-3-[(2-bromo-1,3-thiazol-5-yl)methylamino]-2-cyano-4-methylpent-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxyethyl (E)-3-[(2-bromo-1,3-thiazol-5-yl)methylamino]-2-cyano-4-methylpent-2-enoate?
The IUPAC name of 2-ethoxyethyl (E)-3-[(2-bromo-1,3-thiazol-5-yl)methylamino]-2-cyano-4-methylpent-2-enoate (CID 101458297) is 2-ethoxyethyl (E)-3-[(2-bromo-1,3-thiazol-5-yl)methylamino]-2-cyano-4-methylpent-2-enoate.
What is the SMILES notation for 2-ethoxyethyl (E)-3-[(2-bromo-1,3-thiazol-5-yl)methylamino]-2-cyano-4-methylpent-2-enoate?
The canonical SMILES for 2-ethoxyethyl (E)-3-[(2-bromo-1,3-thiazol-5-yl)methylamino]-2-cyano-4-methylpent-2-enoate is CCOCCOC(=O)/C(C#N)=C(/NCc1cnc(Br)s1)C(C)C.
What is the InChIKey of 2-ethoxyethyl (E)-3-[(2-bromo-1,3-thiazol-5-yl)methylamino]-2-cyano-4-methylpent-2-enoate?
The InChIKey is RBHZNOYCNLDBKC-OUKQBFOZSA-N. The full InChI is InChI=1S/C15H20BrN3O3S/c1-4-21-5-6-22-14(20)12(7-17)13(10(2)3)18-8-11-9-19-15(16)23-11/h9-10,18H,4-6,8H2,1-3H3/b13-12+.
What are the key properties of 2-ethoxyethyl (E)-3-[(2-bromo-1,3-thiazol-5-yl)methylamino]-2-cyano-4-methylpent-2-enoate?
2-ethoxyethyl (E)-3-[(2-bromo-1,3-thiazol-5-yl)methylamino]-2-cyano-4-methylpent-2-enoate has a molecular weight of 402.31 g/mol, XLogP of 3.01, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyethyl (E)-3-[(2-bromo-1,3-thiazol-5-yl)methylamino]-2-cyano-4-methylpent-2-enoate is sourced from PubChem (CID 101458297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).