About tert-butyl 5-(4-fluorophenyl)-2,3-diphenylpyrrole-1-carboxylate
tert-butyl 5-(4-fluorophenyl)-2,3-diphenylpyrrole-1-carboxylate (PubChem CID 101458522) has the molecular formula C27H24FNO2
and a molecular weight of 413.49 g/mol. Its IUPAC name is tert-butyl 5-(4-fluorophenyl)-2,3-diphenylpyrrole-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 5-(4-fluorophenyl)-2,3-diphenylpyrrole-1-carboxylate |
| PubChem CID | 101458522 |
| Molecular Formula | C27H24FNO2 |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | tert-butyl 5-(4-fluorophenyl)-2,3-diphenylpyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c(-c2ccc(F)cc2)cc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C27H24FNO2/c1-27(2,3)31-26(30)29-24(20-14-16-22(28)17-15-20)18-23(19-10-6-4-7-11-19)25(29)21-12-8-5-9-13-21/h4-18H,1-3H3 |
| InChIKey | UHHAHADPVLRTIY-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 5-(4-fluorophenyl)-2,3-diphenylpyrrole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 5-(4-fluorophenyl)-2,3-diphenylpyrrole-1-carboxylate?
The IUPAC name of tert-butyl 5-(4-fluorophenyl)-2,3-diphenylpyrrole-1-carboxylate (CID 101458522) is tert-butyl 5-(4-fluorophenyl)-2,3-diphenylpyrrole-1-carboxylate.
What is the SMILES notation for tert-butyl 5-(4-fluorophenyl)-2,3-diphenylpyrrole-1-carboxylate?
The canonical SMILES for tert-butyl 5-(4-fluorophenyl)-2,3-diphenylpyrrole-1-carboxylate is CC(C)(C)OC(=O)n1c(-c2ccc(F)cc2)cc(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of tert-butyl 5-(4-fluorophenyl)-2,3-diphenylpyrrole-1-carboxylate?
The InChIKey is UHHAHADPVLRTIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H24FNO2/c1-27(2,3)31-26(30)29-24(20-14-16-22(28)17-15-20)18-23(19-10-6-4-7-11-19)25(29)21-12-8-5-9-13-21/h4-18H,1-3H3.
What are the key properties of tert-butyl 5-(4-fluorophenyl)-2,3-diphenylpyrrole-1-carboxylate?
tert-butyl 5-(4-fluorophenyl)-2,3-diphenylpyrrole-1-carboxylate has a molecular weight of 413.49 g/mol, XLogP of 7.41, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 5-(4-fluorophenyl)-2,3-diphenylpyrrole-1-carboxylate is sourced from PubChem (CID 101458522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).