C27H26FNO2 — CID 101458530
tert-butyl (2S)-2-(4-fluorophenyl)-4,5-diphenyl-2,3-dihydropyrrole-1-carboxylate (PubChem CID 101458530) has the molecular formula C27H26FNO2 and a molecular weight of 415.51 g/mol. Its IUPAC name is tert-butyl (2S)-2-(4-fluorophenyl)-4,5-diphenyl-2,3-dihydropyrrole-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-(4-fluorophenyl)-4,5-diphenyl-2,3-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 101458530 |
| Molecular Formula | C27H26FNO2 |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | tert-butyl (2S)-2-(4-fluorophenyl)-4,5-diphenyl-2,3-dihydropyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(c2ccccc2)=C(c2ccccc2)C[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C27H26FNO2/c1-27(2,3)31-26(30)29-24(20-14-16-22(28)17-15-20)18-23(19-10-6-4-7-11-19)25(29)21-12-8-5-9-13-21/h4-17,24H,18H2,1-3H3/t24-/m0/s1 |
| InChIKey | JDMGDMXARUEYQI-DEOSSOPVSA-N |
| XLogP | 7.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|