C20H28O6 — CID 101458574
4,7-dihydroxy-2-(2-hydroxypropan-2-yl)-7-(3-methylbut-2-enyl)-5-(2-methylpropanoyl)-2,3-dihydro-1-benzofuran-6-one (PubChem CID 101458574) has the molecular formula C20H28O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is 4,7-dihydroxy-2-(2-hydroxypropan-2-yl)-7-(3-methylbut-2-enyl)-5-(2-methylpropanoyl)-2,3-dihydro-1-benzofuran-6-one.
| Compound Name | 4,7-dihydroxy-2-(2-hydroxypropan-2-yl)-7-(3-methylbut-2-enyl)-5-(2-methylpropanoyl)-2,3-dihydro-1-benzofuran-6-one |
|---|---|
| PubChem CID | 101458574 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 4,7-dihydroxy-2-(2-hydroxypropan-2-yl)-7-(3-methylbut-2-enyl)-5-(2-methylpropanoyl)-2,3-dihydro-1-benzofuran-6-one |
| SMILES | CC(C)=CCC1(O)C(=O)C(C(=O)C(C)C)=C(O)C2=C1OC(C(C)(C)O)C2 |
| InChI | InChI=1S/C20H28O6/c1-10(2)7-8-20(25)17(23)14(15(21)11(3)4)16(22)12-9-13(19(5,6)24)26-18(12)20/h7,11,13,22,24-25H,8-9H2,1-6H3 |
| InChIKey | VOGIVLZJWMDAJB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|