C14H21Cl3O4 — CID 101459176
2,2,2-trichloroethyl (2Z)-2-(4,4-dimethyloxolan-2-ylidene)-3-ethoxybutanoate (PubChem CID 101459176) has the molecular formula C14H21Cl3O4 and a molecular weight of 359.68 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (2Z)-2-(4,4-dimethyloxolan-2-ylidene)-3-ethoxybutanoate.
| Compound Name | 2,2,2-trichloroethyl (2Z)-2-(4,4-dimethyloxolan-2-ylidene)-3-ethoxybutanoate |
|---|---|
| PubChem CID | 101459176 |
| Molecular Formula | C14H21Cl3O4 |
| Molecular Weight | 359.68 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | 2,2,2-trichloroethyl (2Z)-2-(4,4-dimethyloxolan-2-ylidene)-3-ethoxybutanoate |
| SMILES | CCOC(C)/C(C(=O)OCC(Cl)(Cl)Cl)=C1\CC(C)(C)CO1 |
| InChI | InChI=1S/C14H21Cl3O4/c1-5-19-9(2)11(10-6-13(3,4)7-20-10)12(18)21-8-14(15,16)17/h9H,5-8H2,1-4H3/b11-10- |
| InChIKey | NEBYHLAUARBNGH-KHPPLWFESA-N |
| XLogP | 4.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.68 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|