About 2,2,2-trichloroethyl (2Z)-2-(3H-2-benzofuran-1-ylidene)-3-ethoxybutanoate
2,2,2-trichloroethyl (2Z)-2-(3H-2-benzofuran-1-ylidene)-3-ethoxybutanoate (PubChem CID 101459187) has the molecular formula C16H17Cl3O4
and a molecular weight of 379.67 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (2Z)-2-(3H-2-benzofuran-1-ylidene)-3-ethoxybutanoate.
Molecular Properties
| Compound Name | 2,2,2-trichloroethyl (2Z)-2-(3H-2-benzofuran-1-ylidene)-3-ethoxybutanoate |
| PubChem CID | 101459187 |
| Molecular Formula | C16H17Cl3O4 |
| Molecular Weight | 379.67 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | 2,2,2-trichloroethyl (2Z)-2-(3H-2-benzofuran-1-ylidene)-3-ethoxybutanoate |
| SMILES | CCOC(C)/C(C(=O)OCC(Cl)(Cl)Cl)=C1/OCc2ccccc21 |
| InChI | InChI=1S/C16H17Cl3O4/c1-3-21-10(2)13(15(20)23-9-16(17,18)19)14-12-7-5-4-6-11(12)8-22-14/h4-7,10H,3,8-9H2,1-2H3/b14-13- |
| InChIKey | USKWUNKMMQUQOO-YPKPFQOOSA-N |
| XLogP | 4.27 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.67 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2,2,2-trichloroethyl (2Z)-2-(3H-2-benzofuran-1-ylidene)-3-ethoxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trichloroethyl (2Z)-2-(3H-2-benzofuran-1-ylidene)-3-ethoxybutanoate?
The IUPAC name of 2,2,2-trichloroethyl (2Z)-2-(3H-2-benzofuran-1-ylidene)-3-ethoxybutanoate (CID 101459187) is 2,2,2-trichloroethyl (2Z)-2-(3H-2-benzofuran-1-ylidene)-3-ethoxybutanoate.
What is the SMILES notation for 2,2,2-trichloroethyl (2Z)-2-(3H-2-benzofuran-1-ylidene)-3-ethoxybutanoate?
The canonical SMILES for 2,2,2-trichloroethyl (2Z)-2-(3H-2-benzofuran-1-ylidene)-3-ethoxybutanoate is CCOC(C)/C(C(=O)OCC(Cl)(Cl)Cl)=C1/OCc2ccccc21.
What is the InChIKey of 2,2,2-trichloroethyl (2Z)-2-(3H-2-benzofuran-1-ylidene)-3-ethoxybutanoate?
The InChIKey is USKWUNKMMQUQOO-YPKPFQOOSA-N. The full InChI is InChI=1S/C16H17Cl3O4/c1-3-21-10(2)13(15(20)23-9-16(17,18)19)14-12-7-5-4-6-11(12)8-22-14/h4-7,10H,3,8-9H2,1-2H3/b14-13-.
What are the key properties of 2,2,2-trichloroethyl (2Z)-2-(3H-2-benzofuran-1-ylidene)-3-ethoxybutanoate?
2,2,2-trichloroethyl (2Z)-2-(3H-2-benzofuran-1-ylidene)-3-ethoxybutanoate has a molecular weight of 379.67 g/mol, XLogP of 4.27, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trichloroethyl (2Z)-2-(3H-2-benzofuran-1-ylidene)-3-ethoxybutanoate is sourced from PubChem (CID 101459187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).