About methyl (2R)-2-acetyl-1-oxo-1,3-dithiolane-2-carboxylate
methyl (2R)-2-acetyl-1-oxo-1,3-dithiolane-2-carboxylate (PubChem CID 101459292) has the molecular formula C7H10O4S2
and a molecular weight of 222.29 g/mol. Its IUPAC name is methyl (2R)-2-acetyl-1-oxo-1,3-dithiolane-2-carboxylate.
Molecular Properties
| Compound Name | methyl (2R)-2-acetyl-1-oxo-1,3-dithiolane-2-carboxylate |
| PubChem CID | 101459292 |
| Molecular Formula | C7H10O4S2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.00 |
| IUPAC Name | methyl (2R)-2-acetyl-1-oxo-1,3-dithiolane-2-carboxylate |
| SMILES | COC(=O)[C@]1(C(C)=O)SCCS1=O |
| InChI | InChI=1S/C7H10O4S2/c1-5(8)7(6(9)11-2)12-3-4-13(7)10/h3-4H2,1-2H3/t7-,13?/m1/s1 |
| InChIKey | LKDKQQJRVRNASK-KMPCPTCDSA-N |
| XLogP | -0.06 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl (2R)-2-acetyl-1-oxo-1,3-dithiolane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-2-acetyl-1-oxo-1,3-dithiolane-2-carboxylate?
The IUPAC name of methyl (2R)-2-acetyl-1-oxo-1,3-dithiolane-2-carboxylate (CID 101459292) is methyl (2R)-2-acetyl-1-oxo-1,3-dithiolane-2-carboxylate.
What is the SMILES notation for methyl (2R)-2-acetyl-1-oxo-1,3-dithiolane-2-carboxylate?
The canonical SMILES for methyl (2R)-2-acetyl-1-oxo-1,3-dithiolane-2-carboxylate is COC(=O)[C@]1(C(C)=O)SCCS1=O.
What is the InChIKey of methyl (2R)-2-acetyl-1-oxo-1,3-dithiolane-2-carboxylate?
The InChIKey is LKDKQQJRVRNASK-KMPCPTCDSA-N. The full InChI is InChI=1S/C7H10O4S2/c1-5(8)7(6(9)11-2)12-3-4-13(7)10/h3-4H2,1-2H3/t7-,13?/m1/s1.
What are the key properties of methyl (2R)-2-acetyl-1-oxo-1,3-dithiolane-2-carboxylate?
methyl (2R)-2-acetyl-1-oxo-1,3-dithiolane-2-carboxylate has a molecular weight of 222.29 g/mol, XLogP of -0.06, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-acetyl-1-oxo-1,3-dithiolane-2-carboxylate is sourced from PubChem (CID 101459292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).