C14H17Br3 — CID 101459435
1-bromo-2-(1,1-dibromooct-1-en-2-yl)benzene (PubChem CID 101459435) has the molecular formula C14H17Br3 and a molecular weight of 425.00 g/mol. Its IUPAC name is 1-bromo-2-(1,1-dibromooct-1-en-2-yl)benzene.
| Compound Name | 1-bromo-2-(1,1-dibromooct-1-en-2-yl)benzene |
|---|---|
| PubChem CID | 101459435 |
| Molecular Formula | C14H17Br3 |
| Molecular Weight | 425.00 g/mol |
| Exact Mass | 421.89 |
| IUPAC Name | 1-bromo-2-(1,1-dibromooct-1-en-2-yl)benzene |
| SMILES | CCCCCCC(=C(Br)Br)c1ccccc1Br |
| InChI | InChI=1S/C14H17Br3/c1-2-3-4-5-9-12(14(16)17)11-8-6-7-10-13(11)15/h6-8,10H,2-5,9H2,1H3 |
| InChIKey | ZXWBRVWTMHIDKX-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.00 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|