C12HCl7 — CID 101459964
1,2,3,4,5,6,7-heptachlorobiphenylene (PubChem CID 101459964) has the molecular formula C12HCl7 and a molecular weight of 393.31 g/mol. Its IUPAC name is 1,2,3,4,5,6,7-heptachlorobiphenylene.
| Compound Name | 1,2,3,4,5,6,7-heptachlorobiphenylene |
|---|---|
| PubChem CID | 101459964 |
| Molecular Formula | C12HCl7 |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 389.79 |
| IUPAC Name | 1,2,3,4,5,6,7-heptachlorobiphenylene |
| SMILES | Clc1cc2c(c(Cl)c1Cl)-c1c(Cl)c(Cl)c(Cl)c(Cl)c1-2 |
| InChI | InChI=1S/C12HCl7/c13-3-1-2-4(8(15)7(3)14)6-5(2)9(16)11(18)12(19)10(6)17/h1H |
| InChIKey | BHGZMTXYPSGIKZ-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|