C20H26N2O4S2 — CID 101460140
10,13,16,19-tetraoxa-7,22-dithia-27,28-diazatricyclo[21.3.1.12,6]octacosa-1(27),2(28),3,5,23,25-hexaene (PubChem CID 101460140) has the molecular formula C20H26N2O4S2 and a molecular weight of 422.57 g/mol. Its IUPAC name is 10,13,16,19-tetraoxa-7,22-dithia-27,28-diazatricyclo[21.3.1.12,6]octacosa-1(27),2(28),3,5,23,25-hexaene.
| Compound Name | 10,13,16,19-tetraoxa-7,22-dithia-27,28-diazatricyclo[21.3.1.12,6]octacosa-1(27),2(28),3,5,23,25-hexaene |
|---|---|
| PubChem CID | 101460140 |
| Molecular Formula | C20H26N2O4S2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 10,13,16,19-tetraoxa-7,22-dithia-27,28-diazatricyclo[21.3.1.12,6]octacosa-1(27),2(28),3,5,23,25-hexaene |
| SMILES | c1cc2nc(c1)-c1cccc(n1)SCCOCCOCCOCCOCCS2 |
| InChI | InChI=1S/C20H26N2O4S2/c1-3-17-18-4-2-6-20(22-18)28-16-14-26-12-10-24-8-7-23-9-11-25-13-15-27-19(5-1)21-17/h1-6H,7-16H2 |
| InChIKey | IFVDLWAZKHKMSB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |