C23H28N2O4 — CID 101460182
benzyl (2S)-1-[(2S)-2-(phenylmethoxycarbonylamino)propyl]pyrrolidine-2-carboxylate (PubChem CID 101460182) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is benzyl (2S)-1-[(2S)-2-(phenylmethoxycarbonylamino)propyl]pyrrolidine-2-carboxylate.
| Compound Name | benzyl (2S)-1-[(2S)-2-(phenylmethoxycarbonylamino)propyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 101460182 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | benzyl (2S)-1-[(2S)-2-(phenylmethoxycarbonylamino)propyl]pyrrolidine-2-carboxylate |
| SMILES | C[C@@H](CN1CCC[C@H]1C(=O)OCc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H28N2O4/c1-18(24-23(27)29-17-20-11-6-3-7-12-20)15-25-14-8-13-21(25)22(26)28-16-19-9-4-2-5-10-19/h2-7,9-12,18,21H,8,13-17H2,1H3,(H,24,27)/t18-,21-/m0/s1 |
| InChIKey | LYEXZRWONHWLFD-RXVVDRJESA-N |
| XLogP | 3.51 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |